Tingnan ang wikitext ng Vincristine

{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 461759697
| IUPAC_name = (3aR,3a1R,4R,5S,5aR,10bR)-methyl 4-acetoxy-3a-ethyl-9-((5S,7S,9S)-5-ethyl-5-hydroxy-9-(methoxycarbonyl)-2,4,5,6,7,8,9,10-octahydro-1H-3,7-methano[1]azacycloundecino[5,4-b]indol-9-yl)-6-formyl-5-hydroxy-8-methoxy-3a,3a1,4,5,5a,6,11,12-octahydro-1H-indolizino[8,1-cd]carbazole-5-carboxylate
| image = Vincristine.svg

<!--Clinical data-->
| tradename = 
| Drugs.com = {{drugs.com|monograph|vincristine-sulfate}}
| MedlinePlus = a682822
| pregnancy_AU = D
| pregnancy_US = D
| legal_status = Rx-only
| routes_of_administration = '''Exclusively''' [[Intravenous therapy|intravenous]]

<!--Pharmacokinetic data-->
| bioavailability = n/a
| protein_bound = ~75%
| metabolism = [[Liver|Hepatic]]
| elimination_half-life = 19 to 155 hours
| excretion = Mostly biliary, 10% in urine

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 57-22-7
| ATC_prefix = L01
| ATC_suffix = CA02
| ATC_supplemental =  
| PubChem = 5978
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 | DrugBank = DB00541
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5758
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5J49Q6B70F
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08679
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28445
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 303560

<!--Chemical data-->
| C=46 | H=56 | N=4 | O=10 
| molecular_weight = 824.958 g/mol
| smiles = O=C(OC)[C@]4(c2c(c1ccccc1n2)CCN3C[C@](O)(CC)C[C@@H](C3)C4)c5c(OC)cc6c(c5)[C@@]89[C@@H](N6C=O)[C@@](O)(C(=O)OC)[C@H](OC(=O)C)[C@@]7(/C=C\CN([C@@H]78)CC9)CC
| InChI = 1/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)
| InChIKey = OGWKCGZFUXNPDA-XQKSVPLYBW
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OGWKCGZFUXNPDA-XQKSVPLYSA-N
}}

Ang '''Vincristine''' (tatak na pangalan na Oncovin) na pormal na kilala bilang f'''leurocristine''' na minsang pinaikli na "VCR" ay isang [[vinca alkaloid]] mula sa ''[[Catharanthus roseus]]'' (Madagascar periwinkle) na dating ''Vinca rosea'' at kaya ito ang pangalan nito. Ito ay isang [[tagapigil ng mitosis]] at ginagamit sa [[kemoterapiya]] ng [[kanser]]. Ang Vincristine ay nililikha sa pamamagitan ng pagsasama ng indole alkaloids vindoline at catharanthine sa halamang vinca.<ref>{{cite web | url = http://pharmaxchange.info/press/2012/01/pharmacognosy-of-vinca-alkaloids-periwinkle/ | title = Pharmacognosy of Vinca Alkaloids | access-date = 2012-08-28 | archive-date = 2012-01-06 | archive-url = https://web.archive.org/web/20120106234053/http://pharmaxchange.info/press/2012/01/pharmacognosy-of-vinca-alkaloids-periwinkle/ | url-status = dead }}</ref>
==Mga sanggunian==
{{reflist}}

[[Kategorya:Mga droga sa paggamot ng kanser]]
[[Kategorya:Mga kompuwestong kimikal]]